![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - human entertainment logo.spc | 2020-03-04 23:57 | 65K | |
| 02 - title screen.spc | 2020-03-04 23:57 | 65K | |
| 03 - fire at metro chemical.spc | 2020-03-04 23:57 | 65K | |
| 04 - get the mdl!.spc | 2020-03-04 23:57 | 65K | |
| 05 - to the boiler room!.spc | 2020-03-04 23:57 | 65K | |
| 06 - reach the control room!.spc | 2020-03-04 23:57 | 65K | |
| 07 - rush to the roof!.spc | 2020-03-04 23:57 | 65K | |
| 08 - last resort.spc | 2020-03-04 23:57 | 65K | |
| 09 - final mission.spc | 2020-03-04 23:57 | 65K | |
| 10 - raging fire.spc | 2020-03-04 23:57 | 65K | |
| 11 - stage clear.spc | 2020-03-04 23:57 | 65K | |
| 12 - final stage clear.spc | 2020-03-04 23:57 | 65K | |
| 13 - ending.spc | 2020-03-04 23:57 | 65K | |
| 14 - staff roll.spc | 2020-03-04 23:57 | 65K | |
| 15 - game over.spc | 2020-03-04 23:57 | 65K | |
| boss defeated.spc | 2020-03-04 23:57 | 65K | |